C19H19N3O6 — CID 1241058
phenyl (2S,4R)-4-hydroxy-2-[(2-methyl-5-nitrophenyl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 1241058) has the molecular formula C19H19N3O6 and a molecular weight of 385.38 g/mol. Its IUPAC name is phenyl (2S,4R)-4-hydroxy-2-[(2-methyl-5-nitrophenyl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | phenyl (2S,4R)-4-hydroxy-2-[(2-methyl-5-nitrophenyl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 1241058 |
| Molecular Formula | C19H19N3O6 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | phenyl (2S,4R)-4-hydroxy-2-[(2-methyl-5-nitrophenyl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H]1C[C@@H](O)CN1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C19H19N3O6/c1-12-7-8-13(22(26)27)9-16(12)20-18(24)17-10-14(23)11-21(17)19(25)28-15-5-3-2-4-6-15/h2-9,14,17,23H,10-11H2,1H3,(H,20,24)/t14-,17+/m1/s1 |
| InChIKey | DTSSYYZRVIDJQE-PBHICJAKSA-N |
| XLogP | 2.48 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|