C19H19NO5 — CID 139799318
diphenyl (2S,5R)-5-hydroxypiperidine-1,2-dicarboxylate (PubChem CID 139799318) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is diphenyl (2S,5R)-5-hydroxypiperidine-1,2-dicarboxylate.
| Compound Name | diphenyl (2S,5R)-5-hydroxypiperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139799318 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | diphenyl (2S,5R)-5-hydroxypiperidine-1,2-dicarboxylate |
| SMILES | O=C(Oc1ccccc1)[C@@H]1CC[C@@H](O)CN1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C19H19NO5/c21-14-11-12-17(18(22)24-15-7-3-1-4-8-15)20(13-14)19(23)25-16-9-5-2-6-10-16/h1-10,14,17,21H,11-13H2/t14-,17+/m1/s1 |
| InChIKey | DYHSVWQWSNWPRV-PBHICJAKSA-N |
| XLogP | 2.62 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|