C23H22N2O3 — CID 155392150
N-cyclopentyl-6-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]pyridine-3-carboxamide (PubChem CID 155392150) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is N-cyclopentyl-6-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]pyridine-3-carboxamide.
| Compound Name | N-cyclopentyl-6-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155392150 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | N-cyclopentyl-6-[(3-methyl-1,4-dioxonaphthalen-2-yl)methyl]pyridine-3-carboxamide |
| SMILES | CC1=C(Cc2ccc(C(=O)NC3CCCC3)cn2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H22N2O3/c1-14-20(22(27)19-9-5-4-8-18(19)21(14)26)12-17-11-10-15(13-24-17)23(28)25-16-6-2-3-7-16/h4-5,8-11,13,16H,2-3,6-7,12H2,1H3,(H,25,28) |
| InChIKey | BASGEGFANPBPCG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|