C22H26N2O6 — CID 155392845
4-[2-[5-(2-ethoxyethoxymethyl)furan-2-yl]ethynyl]-N-[1-(hydroxyamino)-1-oxobutan-2-yl]benzamide (PubChem CID 155392845) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is 4-[2-[5-(2-ethoxyethoxymethyl)furan-2-yl]ethynyl]-N-[1-(hydroxyamino)-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-[2-[5-(2-ethoxyethoxymethyl)furan-2-yl]ethynyl]-N-[1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 155392845 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 4-[2-[5-(2-ethoxyethoxymethyl)furan-2-yl]ethynyl]-N-[1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
| SMILES | CCOCCOCc1ccc(C#Cc2ccc(C(=O)NC(CC)C(=O)NO)cc2)o1 |
| InChI | InChI=1S/C22H26N2O6/c1-3-20(22(26)24-27)23-21(25)17-8-5-16(6-9-17)7-10-18-11-12-19(30-18)15-29-14-13-28-4-2/h5-6,8-9,11-12,20,27H,3-4,13-15H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | AJGISTGNRUNNJQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 110.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|