C20H20N4O6 — CID 59697340
N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[2-(hydroxyamino)-2-oxoethoxy]phenyl]ethynyl]benzamide (PubChem CID 59697340) has the molecular formula C20H20N4O6 and a molecular weight of 412.40 g/mol. Its IUPAC name is N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[2-(hydroxyamino)-2-oxoethoxy]phenyl]ethynyl]benzamide.
| Compound Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[2-(hydroxyamino)-2-oxoethoxy]phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 59697340 |
| Molecular Formula | C20H20N4O6 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[2-(hydroxyamino)-2-oxoethoxy]phenyl]ethynyl]benzamide |
| SMILES | NC[C@H](NC(=O)c1ccc(C#Cc2ccc(OCC(=O)NO)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C20H20N4O6/c21-11-17(20(27)24-29)22-19(26)15-7-3-13(4-8-15)1-2-14-5-9-16(10-6-14)30-12-18(25)23-28/h3-10,17,28-29H,11-12,21H2,(H,22,26)(H,23,25)(H,24,27)/t17-/m0/s1 |
| InChIKey | PEMCNQCXITULJN-KRWDZBQOSA-N |
| XLogP | -0.47 |
| TPSA | 163.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|