About 3-(3-cyanophenyl)-N'-phenylsulfanylbenzohydrazide
3-(3-cyanophenyl)-N'-phenylsulfanylbenzohydrazide (PubChem CID 155393060) has the molecular formula C20H15N3OS
and a molecular weight of 345.43 g/mol. Its IUPAC name is 3-(3-cyanophenyl)-N'-phenylsulfanylbenzohydrazide.
Molecular Properties
| Compound Name | 3-(3-cyanophenyl)-N'-phenylsulfanylbenzohydrazide |
| PubChem CID | 155393060 |
| Molecular Formula | C20H15N3OS |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 3-(3-cyanophenyl)-N'-phenylsulfanylbenzohydrazide |
| SMILES | N#Cc1cccc(-c2cccc(C(=O)NNSc3ccccc3)c2)c1 |
| InChI | InChI=1S/C20H15N3OS/c21-14-15-6-4-7-16(12-15)17-8-5-9-18(13-17)20(24)22-23-25-19-10-2-1-3-11-19/h1-13,23H,(H,22,24) |
| InChIKey | HEUOTMVTPVIDMU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-cyanophenyl)-N'-phenylsulfanylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-cyanophenyl)-N'-phenylsulfanylbenzohydrazide?
The IUPAC name of 3-(3-cyanophenyl)-N'-phenylsulfanylbenzohydrazide (CID 155393060) is 3-(3-cyanophenyl)-N'-phenylsulfanylbenzohydrazide.
What is the SMILES notation for 3-(3-cyanophenyl)-N'-phenylsulfanylbenzohydrazide?
The canonical SMILES for 3-(3-cyanophenyl)-N'-phenylsulfanylbenzohydrazide is N#Cc1cccc(-c2cccc(C(=O)NNSc3ccccc3)c2)c1.
What is the InChIKey of 3-(3-cyanophenyl)-N'-phenylsulfanylbenzohydrazide?
The InChIKey is HEUOTMVTPVIDMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3OS/c21-14-15-6-4-7-16(12-15)17-8-5-9-18(13-17)20(24)22-23-25-19-10-2-1-3-11-19/h1-13,23H,(H,22,24).
What are the key properties of 3-(3-cyanophenyl)-N'-phenylsulfanylbenzohydrazide?
3-(3-cyanophenyl)-N'-phenylsulfanylbenzohydrazide has a molecular weight of 345.43 g/mol, XLogP of 4.17, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-cyanophenyl)-N'-phenylsulfanylbenzohydrazide is sourced from PubChem (CID 155393060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).