C7H12F3I — CID 155394559
(2S)-1,1,1-trifluoro-3-iodo-2,4-dimethylpentane (PubChem CID 155394559) has the molecular formula C7H12F3I and a molecular weight of 280.07 g/mol. Its IUPAC name is (2S)-1,1,1-trifluoro-3-iodo-2,4-dimethylpentane.
| Compound Name | (2S)-1,1,1-trifluoro-3-iodo-2,4-dimethylpentane |
|---|---|
| PubChem CID | 155394559 |
| Molecular Formula | C7H12F3I |
| Molecular Weight | 280.07 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | (2S)-1,1,1-trifluoro-3-iodo-2,4-dimethylpentane |
| SMILES | CC(C)C(I)[C@@H](C)C(F)(F)F |
| InChI | InChI=1S/C7H12F3I/c1-4(2)6(11)5(3)7(8,9)10/h4-6H,1-3H3/t5-,6?/m1/s1 |
| InChIKey | KWKYPXBVECVNFI-LWOQYNTDSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.07 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|