C19H27FO2 — CID 155395403
(5R,8S,9S,10R,13S)-10-fluoro-9,13-dimethyl-1,2,4,5,6,7,8,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 155395403) has the molecular formula C19H27FO2 and a molecular weight of 306.42 g/mol. Its IUPAC name is (5R,8S,9S,10R,13S)-10-fluoro-9,13-dimethyl-1,2,4,5,6,7,8,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (5R,8S,9S,10R,13S)-10-fluoro-9,13-dimethyl-1,2,4,5,6,7,8,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 155395403 |
| Molecular Formula | C19H27FO2 |
| Molecular Weight | 306.42 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | (5R,8S,9S,10R,13S)-10-fluoro-9,13-dimethyl-1,2,4,5,6,7,8,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12CC[C@]3(C)C(=O)CCC3[C@@H]1CC[C@@H]1CC(=O)CC[C@@]12F |
| InChI | InChI=1S/C19H27FO2/c1-17-9-10-18(2)15(14(17)5-6-16(17)22)4-3-12-11-13(21)7-8-19(12,18)20/h12,14-15H,3-11H2,1-2H3/t12-,14?,15+,17+,18+,19-/m1/s1 |
| InChIKey | AESIIFNUCOPSHW-BVBKEYRUSA-N |
| XLogP | 4.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |