C20H28O2 — CID 21365009
9,10,13-trimethyl-1,2,4,5,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 21365009) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is 9,10,13-trimethyl-1,2,4,5,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | 9,10,13-trimethyl-1,2,4,5,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 21365009 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 9,10,13-trimethyl-1,2,4,5,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | CC12CCC3(C)C(C=CC4CC(=O)CCC43C)C1CCC2=O |
| InChI | InChI=1S/C20H28O2/c1-18-10-11-20(3)16(15(18)6-7-17(18)22)5-4-13-12-14(21)8-9-19(13,20)2/h4-5,13,15-16H,6-12H2,1-3H3 |
| InChIKey | DHOPFPRKCNWUER-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|