C28H36N2OS — CID 155395835
2-cyclopropylsulfanyl-6-ethyl-1-[2-(5-methoxy-1H-indol-3-yl)ethyl]-7-propyl-3,4-dihydro-1H-isoquinoline (PubChem CID 155395835) has the molecular formula C28H36N2OS and a molecular weight of 448.68 g/mol. Its IUPAC name is 2-cyclopropylsulfanyl-6-ethyl-1-[2-(5-methoxy-1H-indol-3-yl)ethyl]-7-propyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-cyclopropylsulfanyl-6-ethyl-1-[2-(5-methoxy-1H-indol-3-yl)ethyl]-7-propyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 155395835 |
| Molecular Formula | C28H36N2OS |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 2-cyclopropylsulfanyl-6-ethyl-1-[2-(5-methoxy-1H-indol-3-yl)ethyl]-7-propyl-3,4-dihydro-1H-isoquinoline |
| SMILES | CCCc1cc2c(cc1CC)CCN(SC1CC1)C2CCc1c[nH]c2ccc(OC)cc12 |
| InChI | InChI=1S/C28H36N2OS/c1-4-6-20-16-26-21(15-19(20)5-2)13-14-30(32-24-9-10-24)28(26)12-7-22-18-29-27-11-8-23(31-3)17-25(22)27/h8,11,15-18,24,28-29H,4-7,9-10,12-14H2,1-3H3 |
| InChIKey | ULZAFLOJAMAHIW-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|