C23H26N2O3 — CID 139399583
6-methoxy-1-[2-(5-methoxy-1H-indol-3-yl)ethyl]-2-methyl-3,4-dihydro-1H-isoquinoline-7-carbaldehyde (PubChem CID 139399583) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 6-methoxy-1-[2-(5-methoxy-1H-indol-3-yl)ethyl]-2-methyl-3,4-dihydro-1H-isoquinoline-7-carbaldehyde.
| Compound Name | 6-methoxy-1-[2-(5-methoxy-1H-indol-3-yl)ethyl]-2-methyl-3,4-dihydro-1H-isoquinoline-7-carbaldehyde |
|---|---|
| PubChem CID | 139399583 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 6-methoxy-1-[2-(5-methoxy-1H-indol-3-yl)ethyl]-2-methyl-3,4-dihydro-1H-isoquinoline-7-carbaldehyde |
| SMILES | COc1ccc2[nH]cc(CCC3c4cc(C=O)c(OC)cc4CCN3C)c2c1 |
| InChI | InChI=1S/C23H26N2O3/c1-25-9-8-15-11-23(28-3)17(14-26)10-20(15)22(25)7-4-16-13-24-21-6-5-18(27-2)12-19(16)21/h5-6,10-14,22,24H,4,7-9H2,1-3H3 |
| InChIKey | DNRWNEIIUXSMIY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|