C25H21ClFN3O3 — CID 155397181
3-[1-[(4-chloro-2-fluoro-3-hydroxyphenyl)methyl]-3,5-diphenylpyrazol-4-yl]-N-hydroxypropanamide (PubChem CID 155397181) has the molecular formula C25H21ClFN3O3 and a molecular weight of 465.91 g/mol. Its IUPAC name is 3-[1-[(4-chloro-2-fluoro-3-hydroxyphenyl)methyl]-3,5-diphenylpyrazol-4-yl]-N-hydroxypropanamide.
| Compound Name | 3-[1-[(4-chloro-2-fluoro-3-hydroxyphenyl)methyl]-3,5-diphenylpyrazol-4-yl]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 155397181 |
| Molecular Formula | C25H21ClFN3O3 |
| Molecular Weight | 465.91 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 3-[1-[(4-chloro-2-fluoro-3-hydroxyphenyl)methyl]-3,5-diphenylpyrazol-4-yl]-N-hydroxypropanamide |
| SMILES | O=C(CCc1c(-c2ccccc2)nn(Cc2ccc(Cl)c(O)c2F)c1-c1ccccc1)NO |
| InChI | InChI=1S/C25H21ClFN3O3/c26-20-13-11-18(22(27)25(20)32)15-30-24(17-9-5-2-6-10-17)19(12-14-21(31)29-33)23(28-30)16-7-3-1-4-8-16/h1-11,13,32-33H,12,14-15H2,(H,29,31) |
| InChIKey | VSRDCXNBPHOPBY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.91 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|