C20H26N2O7S — CID 155400572
2-[2-[2-[[4-(2,6-dioxopiperidin-3-yl)-3,5-dihydro-1H-2,4-benzoxazepin-6-yl]sulfanyl]ethoxy]ethoxy]acetic acid (PubChem CID 155400572) has the molecular formula C20H26N2O7S and a molecular weight of 438.50 g/mol. Its IUPAC name is 2-[2-[2-[[4-(2,6-dioxopiperidin-3-yl)-3,5-dihydro-1H-2,4-benzoxazepin-6-yl]sulfanyl]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[[4-(2,6-dioxopiperidin-3-yl)-3,5-dihydro-1H-2,4-benzoxazepin-6-yl]sulfanyl]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 155400572 |
| Molecular Formula | C20H26N2O7S |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 2-[2-[2-[[4-(2,6-dioxopiperidin-3-yl)-3,5-dihydro-1H-2,4-benzoxazepin-6-yl]sulfanyl]ethoxy]ethoxy]acetic acid |
| SMILES | O=C(O)COCCOCCSc1cccc2c1CN(C1CCC(=O)NC1=O)COC2 |
| InChI | InChI=1S/C20H26N2O7S/c23-18-5-4-16(20(26)21-18)22-10-15-14(11-29-13-22)2-1-3-17(15)30-9-8-27-6-7-28-12-19(24)25/h1-3,16H,4-13H2,(H,24,25)(H,21,23,26) |
| InChIKey | SQHSBHOKSCHADW-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|