About N-[(2E)-4-chloropenta-2,4-dien-2-yl]-1-fluoropropan-2-imine
N-[(2E)-4-chloropenta-2,4-dien-2-yl]-1-fluoropropan-2-imine (PubChem CID 155402546) has the molecular formula C8H11ClFN
and a molecular weight of 175.63 g/mol. Its IUPAC name is N-[(2E)-4-chloropenta-2,4-dien-2-yl]-1-fluoropropan-2-imine.
Molecular Properties
| Compound Name | N-[(2E)-4-chloropenta-2,4-dien-2-yl]-1-fluoropropan-2-imine |
| PubChem CID | 155402546 |
| Molecular Formula | C8H11ClFN |
| Molecular Weight | 175.63 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | N-[(2E)-4-chloropenta-2,4-dien-2-yl]-1-fluoropropan-2-imine |
| SMILES | C=C(Cl)/C=C(C)/N=C(\C)CF |
| InChI | InChI=1S/C8H11ClFN/c1-6(9)4-7(2)11-8(3)5-10/h4H,1,5H2,2-3H3/b7-4+,11-8+ |
| InChIKey | CUTUZNWEKWEZQL-VCABWLAWSA-N |
| XLogP | 3.07 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.63 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2E)-4-chloropenta-2,4-dien-2-yl]-1-fluoropropan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E)-4-chloropenta-2,4-dien-2-yl]-1-fluoropropan-2-imine?
The IUPAC name of N-[(2E)-4-chloropenta-2,4-dien-2-yl]-1-fluoropropan-2-imine (CID 155402546) is N-[(2E)-4-chloropenta-2,4-dien-2-yl]-1-fluoropropan-2-imine.
What is the SMILES notation for N-[(2E)-4-chloropenta-2,4-dien-2-yl]-1-fluoropropan-2-imine?
The canonical SMILES for N-[(2E)-4-chloropenta-2,4-dien-2-yl]-1-fluoropropan-2-imine is C=C(Cl)/C=C(C)/N=C(\C)CF.
What is the InChIKey of N-[(2E)-4-chloropenta-2,4-dien-2-yl]-1-fluoropropan-2-imine?
The InChIKey is CUTUZNWEKWEZQL-VCABWLAWSA-N. The full InChI is InChI=1S/C8H11ClFN/c1-6(9)4-7(2)11-8(3)5-10/h4H,1,5H2,2-3H3/b7-4+,11-8+.
What are the key properties of N-[(2E)-4-chloropenta-2,4-dien-2-yl]-1-fluoropropan-2-imine?
N-[(2E)-4-chloropenta-2,4-dien-2-yl]-1-fluoropropan-2-imine has a molecular weight of 175.63 g/mol, XLogP of 3.07, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E)-4-chloropenta-2,4-dien-2-yl]-1-fluoropropan-2-imine is sourced from PubChem (CID 155402546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).