C10H16ClN — CID 168972454
N-[(2Z)-4-chloropenta-2,4-dien-2-yl]pentan-2-imine (PubChem CID 168972454) has the molecular formula C10H16ClN and a molecular weight of 185.70 g/mol. Its IUPAC name is N-[(2Z)-4-chloropenta-2,4-dien-2-yl]pentan-2-imine.
| Compound Name | N-[(2Z)-4-chloropenta-2,4-dien-2-yl]pentan-2-imine |
|---|---|
| PubChem CID | 168972454 |
| Molecular Formula | C10H16ClN |
| Molecular Weight | 185.70 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | N-[(2Z)-4-chloropenta-2,4-dien-2-yl]pentan-2-imine |
| SMILES | C=C(Cl)/C=C(C)\N=C(/C)CCC |
| InChI | InChI=1S/C10H16ClN/c1-5-6-9(3)12-10(4)7-8(2)11/h7H,2,5-6H2,1,3-4H3/b10-7-,12-9+ |
| InChIKey | LCNSBQBNQKOXSB-PWZCAXEFSA-N |
| XLogP | 3.90 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.70 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|