About [(1S)-1-phenylethyl] 4-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate
[(1S)-1-phenylethyl] 4-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate (PubChem CID 155402605) has the molecular formula C20H25N3O3
and a molecular weight of 355.44 g/mol. Its IUPAC name is [(1S)-1-phenylethyl] 4-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | [(1S)-1-phenylethyl] 4-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate |
| PubChem CID | 155402605 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | [(1S)-1-phenylethyl] 4-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate |
| SMILES | Cc1[nH]ncc1C(=O)NC1CCC(C(=O)O[C@@H](C)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H25N3O3/c1-13-18(12-21-23-13)19(24)22-17-10-8-16(9-11-17)20(25)26-14(2)15-6-4-3-5-7-15/h3-7,12,14,16-17H,8-11H2,1-2H3,(H,21,23)(H,22,24)/t14-,16?,17?/m0/s1 |
| InChIKey | CIUDSDWEZWSOAW-OOHWJJMZSA-N |
| XLogP | 3.31 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1S)-1-phenylethyl] 4-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-phenylethyl] 4-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate?
The IUPAC name of [(1S)-1-phenylethyl] 4-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate (CID 155402605) is [(1S)-1-phenylethyl] 4-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate.
What is the SMILES notation for [(1S)-1-phenylethyl] 4-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate?
The canonical SMILES for [(1S)-1-phenylethyl] 4-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate is Cc1[nH]ncc1C(=O)NC1CCC(C(=O)O[C@@H](C)c2ccccc2)CC1.
What is the InChIKey of [(1S)-1-phenylethyl] 4-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate?
The InChIKey is CIUDSDWEZWSOAW-OOHWJJMZSA-N. The full InChI is InChI=1S/C20H25N3O3/c1-13-18(12-21-23-13)19(24)22-17-10-8-16(9-11-17)20(25)26-14(2)15-6-4-3-5-7-15/h3-7,12,14,16-17H,8-11H2,1-2H3,(H,21,23)(H,22,24)/t14-,16?,17?/m0/s1.
What are the key properties of [(1S)-1-phenylethyl] 4-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate?
[(1S)-1-phenylethyl] 4-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate has a molecular weight of 355.44 g/mol, XLogP of 3.31, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-phenylethyl] 4-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate is sourced from PubChem (CID 155402605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).