C20H25N3O3 — CID 155402605
[(1S)-1-phenylethyl] 4-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate (PubChem CID 155402605) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is [(1S)-1-phenylethyl] 4-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate.
| Compound Name | [(1S)-1-phenylethyl] 4-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 155402605 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | [(1S)-1-phenylethyl] 4-[(5-methyl-1H-pyrazole-4-carbonyl)amino]cyclohexane-1-carboxylate |
| SMILES | Cc1[nH]ncc1C(=O)NC1CCC(C(=O)O[C@@H](C)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H25N3O3/c1-13-18(12-21-23-13)19(24)22-17-10-8-16(9-11-17)20(25)26-14(2)15-6-4-3-5-7-15/h3-7,12,14,16-17H,8-11H2,1-2H3,(H,21,23)(H,22,24)/t14-,16?,17?/m0/s1 |
| InChIKey | CIUDSDWEZWSOAW-OOHWJJMZSA-N |
| XLogP | 3.31 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |