C14H20N6O — CID 155403345
6-methoxy-N-[(1-piperidin-4-ylpyrazol-4-yl)methyl]pyrazin-2-amine (PubChem CID 155403345) has the molecular formula C14H20N6O and a molecular weight of 288.35 g/mol. Its IUPAC name is 6-methoxy-N-[(1-piperidin-4-ylpyrazol-4-yl)methyl]pyrazin-2-amine.
| Compound Name | 6-methoxy-N-[(1-piperidin-4-ylpyrazol-4-yl)methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 155403345 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 6-methoxy-N-[(1-piperidin-4-ylpyrazol-4-yl)methyl]pyrazin-2-amine |
| SMILES | COc1cncc(NCc2cnn(C3CCNCC3)c2)n1 |
| InChI | InChI=1S/C14H20N6O/c1-21-14-9-16-8-13(19-14)17-6-11-7-18-20(10-11)12-2-4-15-5-3-12/h7-10,12,15H,2-6H2,1H3,(H,17,19) |
| InChIKey | IAYYFOOKXSFWMM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 76.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |