C10H13N5O — CID 155403134
6-methoxy-N-[(1-methylpyrazol-3-yl)methyl]pyrazin-2-amine (PubChem CID 155403134) has the molecular formula C10H13N5O and a molecular weight of 219.25 g/mol. Its IUPAC name is 6-methoxy-N-[(1-methylpyrazol-3-yl)methyl]pyrazin-2-amine.
| Compound Name | 6-methoxy-N-[(1-methylpyrazol-3-yl)methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 155403134 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 6-methoxy-N-[(1-methylpyrazol-3-yl)methyl]pyrazin-2-amine |
| SMILES | COc1cncc(NCc2ccn(C)n2)n1 |
| InChI | InChI=1S/C10H13N5O/c1-15-4-3-8(14-15)5-12-9-6-11-7-10(13-9)16-2/h3-4,6-7H,5H2,1-2H3,(H,12,13) |
| InChIKey | ILMWPVNJZPVCQG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |