C13H14BrN3O — CID 155403354
N-[(4-bromo-3-methylphenyl)methyl]-6-methoxypyrazin-2-amine (PubChem CID 155403354) has the molecular formula C13H14BrN3O and a molecular weight of 308.18 g/mol. Its IUPAC name is N-[(4-bromo-3-methylphenyl)methyl]-6-methoxypyrazin-2-amine.
| Compound Name | N-[(4-bromo-3-methylphenyl)methyl]-6-methoxypyrazin-2-amine |
|---|---|
| PubChem CID | 155403354 |
| Molecular Formula | C13H14BrN3O |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | N-[(4-bromo-3-methylphenyl)methyl]-6-methoxypyrazin-2-amine |
| SMILES | COc1cncc(NCc2ccc(Br)c(C)c2)n1 |
| InChI | InChI=1S/C13H14BrN3O/c1-9-5-10(3-4-11(9)14)6-16-12-7-15-8-13(17-12)18-2/h3-5,7-8H,6H2,1-2H3,(H,16,17) |
| InChIKey | KDULACLUHFBKMR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |