C10H9N5 — CID 155404865
4-methyl-2-(1-methylpyrazol-4-yl)pyrimidine-5-carbonitrile (PubChem CID 155404865) has the molecular formula C10H9N5 and a molecular weight of 199.22 g/mol. Its IUPAC name is 4-methyl-2-(1-methylpyrazol-4-yl)pyrimidine-5-carbonitrile.
| Compound Name | 4-methyl-2-(1-methylpyrazol-4-yl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 155404865 |
| Molecular Formula | C10H9N5 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 4-methyl-2-(1-methylpyrazol-4-yl)pyrimidine-5-carbonitrile |
| SMILES | Cc1nc(-c2cnn(C)c2)ncc1C#N |
| InChI | InChI=1S/C10H9N5/c1-7-8(3-11)4-12-10(14-7)9-5-13-15(2)6-9/h4-6H,1-2H3 |
| InChIKey | REHKDXPMEDVBCJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |