C26H34N8O2 — CID 155405114
2-[6-amino-5-[8-[5-[3-(3-aminopropoxy)propyl]pyrimidin-2-yl]-3,8-diazabicyclo[3.2.1]octan-3-yl]pyridazin-3-yl]phenol (PubChem CID 155405114) has the molecular formula C26H34N8O2 and a molecular weight of 490.61 g/mol. Its IUPAC name is 2-[6-amino-5-[8-[5-[3-(3-aminopropoxy)propyl]pyrimidin-2-yl]-3,8-diazabicyclo[3.2.1]octan-3-yl]pyridazin-3-yl]phenol.
| Compound Name | 2-[6-amino-5-[8-[5-[3-(3-aminopropoxy)propyl]pyrimidin-2-yl]-3,8-diazabicyclo[3.2.1]octan-3-yl]pyridazin-3-yl]phenol |
|---|---|
| PubChem CID | 155405114 |
| Molecular Formula | C26H34N8O2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | 2-[6-amino-5-[8-[5-[3-(3-aminopropoxy)propyl]pyrimidin-2-yl]-3,8-diazabicyclo[3.2.1]octan-3-yl]pyridazin-3-yl]phenol |
| SMILES | NCCCOCCCc1cnc(N2C3CCC2CN(c2cc(-c4ccccc4O)nnc2N)C3)nc1 |
| InChI | InChI=1S/C26H34N8O2/c27-10-4-12-36-11-3-5-18-14-29-26(30-15-18)34-19-8-9-20(34)17-33(16-19)23-13-22(31-32-25(23)28)21-6-1-2-7-24(21)35/h1-2,6-7,13-15,19-20,35H,3-5,8-12,16-17,27H2,(H2,28,32) |
| InChIKey | ILBNVLZOHNRIHW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|