C20H23NO — CID 155405647
3-(4-phenylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine (PubChem CID 155405647) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is 3-(4-phenylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine.
| Compound Name | 3-(4-phenylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 155405647 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 3-(4-phenylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine |
| SMILES | c1ccc(-c2ccc(C3CN4CCCCC4CO3)cc2)cc1 |
| InChI | InChI=1S/C20H23NO/c1-2-6-16(7-3-1)17-9-11-18(12-10-17)20-14-21-13-5-4-8-19(21)15-22-20/h1-3,6-7,9-12,19-20H,4-5,8,13-15H2 |
| InChIKey | WZPFKGYXBAIAAQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |