C10H18N2O6 — CID 155406485
tert-butyl (3-hydroxy-1-methoxy-2-oxo-1,3-diazinan-4-yl) carbonate (PubChem CID 155406485) has the molecular formula C10H18N2O6 and a molecular weight of 262.26 g/mol. Its IUPAC name is tert-butyl (3-hydroxy-1-methoxy-2-oxo-1,3-diazinan-4-yl) carbonate.
| Compound Name | tert-butyl (3-hydroxy-1-methoxy-2-oxo-1,3-diazinan-4-yl) carbonate |
|---|---|
| PubChem CID | 155406485 |
| Molecular Formula | C10H18N2O6 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | tert-butyl (3-hydroxy-1-methoxy-2-oxo-1,3-diazinan-4-yl) carbonate |
| SMILES | CON1CCC(OC(=O)OC(C)(C)C)N(O)C1=O |
| InChI | InChI=1S/C10H18N2O6/c1-10(2,3)18-9(14)17-7-5-6-11(16-4)8(13)12(7)15/h7,15H,5-6H2,1-4H3 |
| InChIKey | OUGHFYOLDLTXNC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|