About tert-butyl (1-ethylpyrrolidin-2-yl) carbonate
tert-butyl (1-ethylpyrrolidin-2-yl) carbonate (PubChem CID 54008196) has the molecular formula C11H21NO3
and a molecular weight of 215.29 g/mol. Its IUPAC name is tert-butyl (1-ethylpyrrolidin-2-yl) carbonate.
Molecular Properties
| Compound Name | tert-butyl (1-ethylpyrrolidin-2-yl) carbonate |
| PubChem CID | 54008196 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | tert-butyl (1-ethylpyrrolidin-2-yl) carbonate |
| SMILES | CCN1CCCC1OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H21NO3/c1-5-12-8-6-7-9(12)14-10(13)15-11(2,3)4/h9H,5-8H2,1-4H3 |
| InChIKey | SKGUSOKTQKFENK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl (1-ethylpyrrolidin-2-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (1-ethylpyrrolidin-2-yl) carbonate?
The IUPAC name of tert-butyl (1-ethylpyrrolidin-2-yl) carbonate (CID 54008196) is tert-butyl (1-ethylpyrrolidin-2-yl) carbonate.
What is the SMILES notation for tert-butyl (1-ethylpyrrolidin-2-yl) carbonate?
The canonical SMILES for tert-butyl (1-ethylpyrrolidin-2-yl) carbonate is CCN1CCCC1OC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (1-ethylpyrrolidin-2-yl) carbonate?
The InChIKey is SKGUSOKTQKFENK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3/c1-5-12-8-6-7-9(12)14-10(13)15-11(2,3)4/h9H,5-8H2,1-4H3.
What are the key properties of tert-butyl (1-ethylpyrrolidin-2-yl) carbonate?
tert-butyl (1-ethylpyrrolidin-2-yl) carbonate has a molecular weight of 215.29 g/mol, XLogP of 2.38, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (1-ethylpyrrolidin-2-yl) carbonate is sourced from PubChem (CID 54008196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).