C33H35N5O5 — CID 155406821
(1S)-12-phenyl-17,20-dioxa-5,9,14,26,28-pentazahexacyclo[22.5.2.11,4.13,7.110,14.027,30]tetratriaconta-3,5,7(33),24(31),25,27(30)-hexaene-8,29,32-trione (PubChem CID 155406821) has the molecular formula C33H35N5O5 and a molecular weight of 581.67 g/mol. Its IUPAC name is (1S)-12-phenyl-17,20-dioxa-5,9,14,26,28-pentazahexacyclo[22.5.2.11,4.13,7.110,14.027,30]tetratriaconta-3,5,7(33),24(31),25,27(30)-hexaene-8,29,32-trione.
| Compound Name | (1S)-12-phenyl-17,20-dioxa-5,9,14,26,28-pentazahexacyclo[22.5.2.11,4.13,7.110,14.027,30]tetratriaconta-3,5,7(33),24(31),25,27(30)-hexaene-8,29,32-trione |
|---|---|
| PubChem CID | 155406821 |
| Molecular Formula | C33H35N5O5 |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | (1S)-12-phenyl-17,20-dioxa-5,9,14,26,28-pentazahexacyclo[22.5.2.11,4.13,7.110,14.027,30]tetratriaconta-3,5,7(33),24(31),25,27(30)-hexaene-8,29,32-trione |
| SMILES | O=C1NC2CC(c3ccccc3)CN(CCOCCOCCCc3cnc4c(c3)[C@@]3(Cc5cc1cnc5C3)C(=O)N4)C2=O |
| InChI | InChI=1S/C33H35N5O5/c39-30-24-14-23-16-33(17-28(23)34-19-24)26-13-21(18-35-29(26)37-32(33)41)5-4-9-42-11-12-43-10-8-38-20-25(15-27(36-30)31(38)40)22-6-2-1-3-7-22/h1-3,6-7,13-14,18-19,25,27H,4-5,8-12,15-17,20H2,(H,36,39)(H,35,37,41)/t25?,27?,33-/m0/s1 |
| InChIKey | AYXNDYGGSKGQAU-RAXKPYPPSA-N |
| XLogP | 2.56 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |