C17H15F2IN4O2S — CID 155414723
ethyl 2-(4-fluoro-6-iodoindazol-2-yl)-2-(6-fluoro-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl)acetate (PubChem CID 155414723) has the molecular formula C17H15F2IN4O2S and a molecular weight of 504.30 g/mol. Its IUPAC name is ethyl 2-(4-fluoro-6-iodoindazol-2-yl)-2-(6-fluoro-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl)acetate.
| Compound Name | ethyl 2-(4-fluoro-6-iodoindazol-2-yl)-2-(6-fluoro-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl)acetate |
|---|---|
| PubChem CID | 155414723 |
| Molecular Formula | C17H15F2IN4O2S |
| Molecular Weight | 504.30 g/mol |
| Exact Mass | 503.99 |
| IUPAC Name | ethyl 2-(4-fluoro-6-iodoindazol-2-yl)-2-(6-fluoro-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl)acetate |
| SMILES | CCOC(=O)C(c1[nH]c(=S)n2c1CC(F)C2)n1cc2c(F)cc(I)cc2n1 |
| InChI | InChI=1S/C17H15F2IN4O2S/c1-2-26-16(25)15(14-13-3-8(18)6-23(13)17(27)21-14)24-7-10-11(19)4-9(20)5-12(10)22-24/h4-5,7-8,15H,2-3,6H2,1H3,(H,21,27) |
| InChIKey | FGFKFOIMYPIMFC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.30 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|