C29H42O2PS2+ — CID 155415875
[4-[2-(benzenecarbonothioylsulfanyl)propanoyloxymethyl]phenyl]methyl-dimethyl-nonan-2-ylphosphanium (PubChem CID 155415875) has the molecular formula C29H42O2PS2+ and a molecular weight of 517.76 g/mol. Its IUPAC name is [4-[2-(benzenecarbonothioylsulfanyl)propanoyloxymethyl]phenyl]methyl-dimethyl-nonan-2-ylphosphanium.
| Compound Name | [4-[2-(benzenecarbonothioylsulfanyl)propanoyloxymethyl]phenyl]methyl-dimethyl-nonan-2-ylphosphanium |
|---|---|
| PubChem CID | 155415875 |
| Molecular Formula | C29H42O2PS2+ |
| Molecular Weight | 517.76 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | [4-[2-(benzenecarbonothioylsulfanyl)propanoyloxymethyl]phenyl]methyl-dimethyl-nonan-2-ylphosphanium |
| SMILES | CCCCCCCC(C)[P+](C)(C)Cc1ccc(COC(=O)C(C)SC(=S)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H42O2PS2/c1-6-7-8-9-11-14-23(2)32(4,5)22-26-19-17-25(18-20-26)21-31-28(30)24(3)34-29(33)27-15-12-10-13-16-27/h10,12-13,15-20,23-24H,6-9,11,14,21-22H2,1-5H3/q+1 |
| InChIKey | MWGMQRVOCBDNJT-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.76 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ester_B(4)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|