C31H38N4O4 — CID 155416204
methyl (2S)-2-[9-[N'-[(E)-2-hydroxyprop-1-enyl]-N-methylidenecarbamimidoyl]-2,7-dimethyl-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetate (PubChem CID 155416204) has the molecular formula C31H38N4O4 and a molecular weight of 530.67 g/mol. Its IUPAC name is methyl (2S)-2-[9-[N'-[(E)-2-hydroxyprop-1-enyl]-N-methylidenecarbamimidoyl]-2,7-dimethyl-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetate.
| Compound Name | methyl (2S)-2-[9-[N'-[(E)-2-hydroxyprop-1-enyl]-N-methylidenecarbamimidoyl]-2,7-dimethyl-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetate |
|---|---|
| PubChem CID | 155416204 |
| Molecular Formula | C31H38N4O4 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | methyl (2S)-2-[9-[N'-[(E)-2-hydroxyprop-1-enyl]-N-methylidenecarbamimidoyl]-2,7-dimethyl-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetate |
| SMILES | C=N/C(=N\C=C(/C)O)N1CCn2c(C)cc3c(-c4ccc(C)cc4)c([C@H](OC(C)(C)C)C(=O)OC)c(C)c1c32 |
| InChI | InChI=1S/C31H38N4O4/c1-18-10-12-22(13-11-18)25-23-16-19(2)34-14-15-35(30(32-8)33-17-20(3)36)26(27(23)34)21(4)24(25)28(29(37)38-9)39-31(5,6)7/h10-13,16-17,28,36H,8,14-15H2,1-7,9H3/b20-17+,33-30+/t28-/m0/s1 |
| InChIKey | UXTNRVYAXXNKRJ-YJTWHALHSA-N |
| XLogP | 6.56 |
| TPSA | 88.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|