C33H40N4O4 — CID 159919765
(2S)-2-[9-(5-butoxypyrimidin-2-yl)-2,7-dimethyl-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid (PubChem CID 159919765) has the molecular formula C33H40N4O4 and a molecular weight of 556.71 g/mol. Its IUPAC name is (2S)-2-[9-(5-butoxypyrimidin-2-yl)-2,7-dimethyl-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid.
| Compound Name | (2S)-2-[9-(5-butoxypyrimidin-2-yl)-2,7-dimethyl-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
|---|---|
| PubChem CID | 159919765 |
| Molecular Formula | C33H40N4O4 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | (2S)-2-[9-(5-butoxypyrimidin-2-yl)-2,7-dimethyl-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
| SMILES | CCCCOc1cnc(N2CCn3c(C)cc4c(-c5ccc(C)cc5)c([C@H](OC(C)(C)C)C(=O)O)c(C)c2c43)nc1 |
| InChI | InChI=1S/C33H40N4O4/c1-8-9-16-40-24-18-34-32(35-19-24)37-15-14-36-21(3)17-25-27(23-12-10-20(2)11-13-23)26(22(4)28(37)29(25)36)30(31(38)39)41-33(5,6)7/h10-13,17-19,30H,8-9,14-16H2,1-7H3,(H,38,39)/t30-/m0/s1 |
| InChIKey | AHLVVNYSOCAZGZ-PMERELPUSA-N |
| XLogP | 7.29 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|