C32H38IN5O4 — CID 134407643
(2S)-2-[9-[5-[2-(ethylamino)ethoxy]pyrimidin-2-yl]-5-(4-iodophenyl)-2,7-dimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid (PubChem CID 134407643) has the molecular formula C32H38IN5O4 and a molecular weight of 683.59 g/mol. Its IUPAC name is (2S)-2-[9-[5-[2-(ethylamino)ethoxy]pyrimidin-2-yl]-5-(4-iodophenyl)-2,7-dimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid.
| Compound Name | (2S)-2-[9-[5-[2-(ethylamino)ethoxy]pyrimidin-2-yl]-5-(4-iodophenyl)-2,7-dimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
|---|---|
| PubChem CID | 134407643 |
| Molecular Formula | C32H38IN5O4 |
| Molecular Weight | 683.59 g/mol |
| Exact Mass | 683.20 |
| IUPAC Name | (2S)-2-[9-[5-[2-(ethylamino)ethoxy]pyrimidin-2-yl]-5-(4-iodophenyl)-2,7-dimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
| SMILES | CCNCCOc1cnc(N2CCn3c(C)cc4c(-c5ccc(I)cc5)c([C@H](OC(C)(C)C)C(=O)O)c(C)c2c43)nc1 |
| InChI | InChI=1S/C32H38IN5O4/c1-7-34-12-15-41-23-17-35-31(36-18-23)38-14-13-37-19(2)16-24-26(21-8-10-22(33)11-9-21)25(20(3)27(38)28(24)37)29(30(39)40)42-32(4,5)6/h8-11,16-18,29,34H,7,12-15H2,1-6H3,(H,39,40)/t29-/m0/s1 |
| InChIKey | KLLFTBHACUIFBW-LJAQVGFWSA-N |
| XLogP | 6.40 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.59 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|