C26H29N2OP — CID 155419780
4-methyl-N-[7-(6-phosphanylquinolin-4-yl)spiro[3.5]nonan-2-yl]benzamide (PubChem CID 155419780) has the molecular formula C26H29N2OP and a molecular weight of 416.51 g/mol. Its IUPAC name is 4-methyl-N-[7-(6-phosphanylquinolin-4-yl)spiro[3.5]nonan-2-yl]benzamide.
| Compound Name | 4-methyl-N-[7-(6-phosphanylquinolin-4-yl)spiro[3.5]nonan-2-yl]benzamide |
|---|---|
| PubChem CID | 155419780 |
| Molecular Formula | C26H29N2OP |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 4-methyl-N-[7-(6-phosphanylquinolin-4-yl)spiro[3.5]nonan-2-yl]benzamide |
| SMILES | Cc1ccc(C(=O)NC2CC3(CCC(c4ccnc5ccc(P)cc45)CC3)C2)cc1 |
| InChI | InChI=1S/C26H29N2OP/c1-17-2-4-19(5-3-17)25(29)28-20-15-26(16-20)11-8-18(9-12-26)22-10-13-27-24-7-6-21(30)14-23(22)24/h2-7,10,13-14,18,20H,8-9,11-12,15-16,30H2,1H3,(H,28,29) |
| InChIKey | DPOMSNXIGHEPBH-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|