C18H23N3O6S — CID 155425413
[5-[(3S)-3-aminopyrrolidin-1-yl]sulfonyl-1-oxoisoquinolin-2-yl]methyl propyl carbonate (PubChem CID 155425413) has the molecular formula C18H23N3O6S and a molecular weight of 409.46 g/mol. Its IUPAC name is [5-[(3S)-3-aminopyrrolidin-1-yl]sulfonyl-1-oxoisoquinolin-2-yl]methyl propyl carbonate.
| Compound Name | [5-[(3S)-3-aminopyrrolidin-1-yl]sulfonyl-1-oxoisoquinolin-2-yl]methyl propyl carbonate |
|---|---|
| PubChem CID | 155425413 |
| Molecular Formula | C18H23N3O6S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | [5-[(3S)-3-aminopyrrolidin-1-yl]sulfonyl-1-oxoisoquinolin-2-yl]methyl propyl carbonate |
| SMILES | CCCOC(=O)OCn1ccc2c(S(=O)(=O)N3CC[C@H](N)C3)cccc2c1=O |
| InChI | InChI=1S/C18H23N3O6S/c1-2-10-26-18(23)27-12-20-8-7-14-15(17(20)22)4-3-5-16(14)28(24,25)21-9-6-13(19)11-21/h3-5,7-8,13H,2,6,9-12,19H2,1H3/t13-/m0/s1 |
| InChIKey | HXKJLFNCUCSRJV-ZDUSSCGKSA-N |
| XLogP | 1.24 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |