C19H19N3O5S2 — CID 155425213
[5-(3-aminopyrrolidin-1-yl)sulfonyl-1-oxoisoquinolin-2-yl]methyl thiophene-2-carboxylate (PubChem CID 155425213) has the molecular formula C19H19N3O5S2 and a molecular weight of 433.51 g/mol. Its IUPAC name is [5-(3-aminopyrrolidin-1-yl)sulfonyl-1-oxoisoquinolin-2-yl]methyl thiophene-2-carboxylate.
| Compound Name | [5-(3-aminopyrrolidin-1-yl)sulfonyl-1-oxoisoquinolin-2-yl]methyl thiophene-2-carboxylate |
|---|---|
| PubChem CID | 155425213 |
| Molecular Formula | C19H19N3O5S2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | [5-(3-aminopyrrolidin-1-yl)sulfonyl-1-oxoisoquinolin-2-yl]methyl thiophene-2-carboxylate |
| SMILES | NC1CCN(S(=O)(=O)c2cccc3c(=O)n(COC(=O)c4cccs4)ccc23)C1 |
| InChI | InChI=1S/C19H19N3O5S2/c20-13-6-9-22(11-13)29(25,26)17-5-1-3-15-14(17)7-8-21(18(15)23)12-27-19(24)16-4-2-10-28-16/h1-5,7-8,10,13H,6,9,11-12,20H2 |
| InChIKey | QHHVGYYPLSAICC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 111.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |