C24H27ClN4O8S — CID 178027506
[5-[(3S)-3-aminopyrrolidin-1-yl]sulfonyl-4-methyl-1-oxoisoquinolin-2-yl]methyl 4-(1-nitrooxyethyl)benzoate;hydrochloride (PubChem CID 178027506) has the molecular formula C24H27ClN4O8S and a molecular weight of 567.02 g/mol. Its IUPAC name is [5-[(3S)-3-aminopyrrolidin-1-yl]sulfonyl-4-methyl-1-oxoisoquinolin-2-yl]methyl 4-(1-nitrooxyethyl)benzoate;hydrochloride.
| Compound Name | [5-[(3S)-3-aminopyrrolidin-1-yl]sulfonyl-4-methyl-1-oxoisoquinolin-2-yl]methyl 4-(1-nitrooxyethyl)benzoate;hydrochloride |
|---|---|
| PubChem CID | 178027506 |
| Molecular Formula | C24H27ClN4O8S |
| Molecular Weight | 567.02 g/mol |
| Exact Mass | 566.12 |
| IUPAC Name | [5-[(3S)-3-aminopyrrolidin-1-yl]sulfonyl-4-methyl-1-oxoisoquinolin-2-yl]methyl 4-(1-nitrooxyethyl)benzoate;hydrochloride |
| SMILES | Cc1cn(COC(=O)c2ccc(C(C)O[N+](=O)[O-])cc2)c(=O)c2cccc(S(=O)(=O)N3CC[C@H](N)C3)c12.Cl |
| InChI | InChI=1S/C24H26N4O8S.ClH/c1-15-12-26(14-35-24(30)18-8-6-17(7-9-18)16(2)36-28(31)32)23(29)20-4-3-5-21(22(15)20)37(33,34)27-11-10-19(25)13-27;/h3-9,12,16,19H,10-11,13-14,25H2,1-2H3;1H/t16?,19-;/m0./s1 |
| InChIKey | YIXXXPQTKIHFFJ-BKEIEZAHSA-N |
| XLogP | 2.54 |
| TPSA | 164.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.02 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|