C23H31N5O12S — CID 178027561
[5-[(3S)-3-aminopyrrolidin-1-yl]sulfonyl-4-methyl-1-oxoisoquinolin-2-yl]methyl 3-(2,3-dinitrooxypropoxy)-2,2-dimethylpropanoate (PubChem CID 178027561) has the molecular formula C23H31N5O12S and a molecular weight of 601.59 g/mol. Its IUPAC name is [5-[(3S)-3-aminopyrrolidin-1-yl]sulfonyl-4-methyl-1-oxoisoquinolin-2-yl]methyl 3-(2,3-dinitrooxypropoxy)-2,2-dimethylpropanoate.
| Compound Name | [5-[(3S)-3-aminopyrrolidin-1-yl]sulfonyl-4-methyl-1-oxoisoquinolin-2-yl]methyl 3-(2,3-dinitrooxypropoxy)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 178027561 |
| Molecular Formula | C23H31N5O12S |
| Molecular Weight | 601.59 g/mol |
| Exact Mass | 601.17 |
| IUPAC Name | [5-[(3S)-3-aminopyrrolidin-1-yl]sulfonyl-4-methyl-1-oxoisoquinolin-2-yl]methyl 3-(2,3-dinitrooxypropoxy)-2,2-dimethylpropanoate |
| SMILES | Cc1cn(COC(=O)C(C)(C)COCC(CO[N+](=O)[O-])O[N+](=O)[O-])c(=O)c2cccc(S(=O)(=O)N3CC[C@H](N)C3)c12 |
| InChI | InChI=1S/C23H31N5O12S/c1-15-9-25(14-38-22(30)23(2,3)13-37-11-17(40-28(33)34)12-39-27(31)32)21(29)18-5-4-6-19(20(15)18)41(35,36)26-8-7-16(24)10-26/h4-6,9,16-17H,7-8,10-14,24H2,1-3H3/t16-,17?/m0/s1 |
| InChIKey | FZAOLNNHIFFYHH-BHWOMJMDSA-N |
| XLogP | 0.36 |
| TPSA | 225.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.59 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|