C29H34N4O10S — CID 178027617
[4-methyl-5-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]sulfonyl-1-oxoisoquinolin-2-yl]methyl 4-(2-nitrooxyethyl)benzoate (PubChem CID 178027617) has the molecular formula C29H34N4O10S and a molecular weight of 630.68 g/mol. Its IUPAC name is [4-methyl-5-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]sulfonyl-1-oxoisoquinolin-2-yl]methyl 4-(2-nitrooxyethyl)benzoate.
| Compound Name | [4-methyl-5-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]sulfonyl-1-oxoisoquinolin-2-yl]methyl 4-(2-nitrooxyethyl)benzoate |
|---|---|
| PubChem CID | 178027617 |
| Molecular Formula | C29H34N4O10S |
| Molecular Weight | 630.68 g/mol |
| Exact Mass | 630.20 |
| IUPAC Name | [4-methyl-5-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]sulfonyl-1-oxoisoquinolin-2-yl]methyl 4-(2-nitrooxyethyl)benzoate |
| SMILES | Cc1cn(COC(=O)c2ccc(CCO[N+](=O)[O-])cc2)c(=O)c2cccc(S(=O)(=O)N3CC[C@H](NC(=O)OC(C)(C)C)C3)c12 |
| InChI | InChI=1S/C29H34N4O10S/c1-19-16-31(18-41-27(35)21-10-8-20(9-11-21)13-15-42-33(37)38)26(34)23-6-5-7-24(25(19)23)44(39,40)32-14-12-22(17-32)30-28(36)43-29(2,3)4/h5-11,16,22H,12-15,17-18H2,1-4H3,(H,30,36)/t22-/m0/s1 |
| InChIKey | UBYUAHHZDJDZOM-QFIPXVFZSA-N |
| XLogP | 3.16 |
| TPSA | 176.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.68 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|