C9H13FN2O4 — CID 155426123
(2R)-2-amino-5-[[(E)-4-fluoro-4-oxobut-2-enoyl]amino]pentanoic acid (PubChem CID 155426123) has the molecular formula C9H13FN2O4 and a molecular weight of 232.21 g/mol. Its IUPAC name is (2R)-2-amino-5-[[(E)-4-fluoro-4-oxobut-2-enoyl]amino]pentanoic acid.
| Compound Name | (2R)-2-amino-5-[[(E)-4-fluoro-4-oxobut-2-enoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 155426123 |
| Molecular Formula | C9H13FN2O4 |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | (2R)-2-amino-5-[[(E)-4-fluoro-4-oxobut-2-enoyl]amino]pentanoic acid |
| SMILES | N[C@H](CCCNC(=O)/C=C/C(=O)F)C(=O)O |
| InChI | InChI=1S/C9H13FN2O4/c10-7(13)3-4-8(14)12-5-1-2-6(11)9(15)16/h3-4,6H,1-2,5,11H2,(H,12,14)(H,15,16)/b4-3+/t6-/m1/s1 |
| InChIKey | YPNSIRACWREBIA-FCJGRKLLSA-N |
| XLogP | -0.65 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|