C16H28N4O6 — CID 86278351
(2S)-2-amino-6-[[(E)-4-[[(5S)-5-amino-5-carboxypentyl]amino]-4-oxobut-2-enoyl]amino]hexanoic acid (PubChem CID 86278351) has the molecular formula C16H28N4O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is (2S)-2-amino-6-[[(E)-4-[[(5S)-5-amino-5-carboxypentyl]amino]-4-oxobut-2-enoyl]amino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[[(E)-4-[[(5S)-5-amino-5-carboxypentyl]amino]-4-oxobut-2-enoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 86278351 |
| Molecular Formula | C16H28N4O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | (2S)-2-amino-6-[[(E)-4-[[(5S)-5-amino-5-carboxypentyl]amino]-4-oxobut-2-enoyl]amino]hexanoic acid |
| SMILES | N[C@@H](CCCCNC(=O)/C=C/C(=O)NCCCC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H28N4O6/c17-11(15(23)24)5-1-3-9-19-13(21)7-8-14(22)20-10-4-2-6-12(18)16(25)26/h7-8,11-12H,1-6,9-10,17-18H2,(H,19,21)(H,20,22)(H,23,24)(H,25,26)/b8-7+/t11-,12-/m0/s1 |
| InChIKey | CTDXCZVPKQQCPV-BRQSLIGTSA-N |
| XLogP | -1.06 |
| TPSA | 184.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|