C16H30N4O4 — CID 71592733
2-amino-6-[[2-amino-6-(2-methylprop-2-enoylamino)hexanoyl]amino]hexanoic acid (PubChem CID 71592733) has the molecular formula C16H30N4O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-amino-6-[[2-amino-6-(2-methylprop-2-enoylamino)hexanoyl]amino]hexanoic acid.
| Compound Name | 2-amino-6-[[2-amino-6-(2-methylprop-2-enoylamino)hexanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 71592733 |
| Molecular Formula | C16H30N4O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 2-amino-6-[[2-amino-6-(2-methylprop-2-enoylamino)hexanoyl]amino]hexanoic acid |
| SMILES | C=C(C)C(=O)NCCCCC(N)C(=O)NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C16H30N4O4/c1-11(2)14(21)19-9-5-3-7-12(17)15(22)20-10-6-4-8-13(18)16(23)24/h12-13H,1,3-10,17-18H2,2H3,(H,19,21)(H,20,22)(H,23,24) |
| InChIKey | OXAZKTCWQLAYDY-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|