C19H32N4O6 — CID 52942684
(2S)-2-[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-6-(3-methylbut-2-enoylamino)hexanoyl]amino]propanoic acid (PubChem CID 52942684) has the molecular formula C19H32N4O6 and a molecular weight of 412.49 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-6-(3-methylbut-2-enoylamino)hexanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-6-(3-methylbut-2-enoylamino)hexanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 52942684 |
| Molecular Formula | C19H32N4O6 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-6-(3-methylbut-2-enoylamino)hexanoyl]amino]propanoic acid |
| SMILES | CC(=O)N[C@@H](C)C(=O)N[C@@H](CCCCNC(=O)C=C(C)C)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C19H32N4O6/c1-11(2)10-16(25)20-9-7-6-8-15(18(27)22-13(4)19(28)29)23-17(26)12(3)21-14(5)24/h10,12-13,15H,6-9H2,1-5H3,(H,20,25)(H,21,24)(H,22,27)(H,23,26)(H,28,29)/t12-,13-,15-/m0/s1 |
| InChIKey | FSMBZPAWSICZTC-YDHLFZDLSA-N |
| XLogP | -0.16 |
| TPSA | 153.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|