C20H35N5O5 — CID 52947718
(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]-6-(3-methylbut-2-enoylamino)hexanamide (PubChem CID 52947718) has the molecular formula C20H35N5O5 and a molecular weight of 425.53 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]-6-(3-methylbut-2-enoylamino)hexanamide.
| Compound Name | (2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]-6-(3-methylbut-2-enoylamino)hexanamide |
|---|---|
| PubChem CID | 52947718 |
| Molecular Formula | C20H35N5O5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | (2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]-6-(3-methylbut-2-enoylamino)hexanamide |
| SMILES | CNC(=O)[C@H](C)NC(=O)[C@H](CCCCNC(=O)C=C(C)C)NC(=O)[C@H](C)NC(C)=O |
| InChI | InChI=1S/C20H35N5O5/c1-12(2)11-17(27)22-10-8-7-9-16(20(30)24-13(3)18(28)21-6)25-19(29)14(4)23-15(5)26/h11,13-14,16H,7-10H2,1-6H3,(H,21,28)(H,22,27)(H,23,26)(H,24,30)(H,25,29)/t13-,14-,16-/m0/s1 |
| InChIKey | OVRMMZYXPJMFEG-DZKIICNBSA-N |
| XLogP | -0.50 |
| TPSA | 145.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|