C16H30N4O7S — CID 52941632
methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-6-(methanesulfonamido)hexanoyl]amino]propanoate (PubChem CID 52941632) has the molecular formula C16H30N4O7S and a molecular weight of 422.50 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-6-(methanesulfonamido)hexanoyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-6-(methanesulfonamido)hexanoyl]amino]propanoate |
|---|---|
| PubChem CID | 52941632 |
| Molecular Formula | C16H30N4O7S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-6-(methanesulfonamido)hexanoyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)[C@H](CCCCNS(C)(=O)=O)NC(=O)[C@H](C)NC(C)=O |
| InChI | InChI=1S/C16H30N4O7S/c1-10(18-12(3)21)14(22)20-13(8-6-7-9-17-28(5,25)26)15(23)19-11(2)16(24)27-4/h10-11,13,17H,6-9H2,1-5H3,(H,18,21)(H,19,23)(H,20,22)/t10-,11-,13-/m0/s1 |
| InChIKey | GODAQVMWJSVXNR-GVXVVHGQSA-N |
| XLogP | -1.61 |
| TPSA | 159.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|