C15H28N4O4S — CID 87411314
methyl (2S)-2-[[(2S)-2-[[(2S)-6-amino-2-(ethanethioylamino)hexanoyl]amino]propanoyl]amino]propanoate (PubChem CID 87411314) has the molecular formula C15H28N4O4S and a molecular weight of 360.48 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-[[(2S)-6-amino-2-(ethanethioylamino)hexanoyl]amino]propanoyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-[[(2S)-6-amino-2-(ethanethioylamino)hexanoyl]amino]propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 87411314 |
| Molecular Formula | C15H28N4O4S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-[[(2S)-6-amino-2-(ethanethioylamino)hexanoyl]amino]propanoyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CCCCN)NC(C)=S |
| InChI | InChI=1S/C15H28N4O4S/c1-9(13(20)18-10(2)15(22)23-4)17-14(21)12(19-11(3)24)7-5-6-8-16/h9-10,12H,5-8,16H2,1-4H3,(H,17,21)(H,18,20)(H,19,24)/t9-,10-,12-/m0/s1 |
| InChIKey | MZXCHBIKSUIUNE-NHCYSSNCSA-N |
| XLogP | -0.40 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|