C16H32N4O6S — CID 87564470
6-(methanesulfonamido)-2-[[3-methyl-2-[2-(methylamino)propanoylamino]butanoyl]amino]hexanoic acid (PubChem CID 87564470) has the molecular formula C16H32N4O6S and a molecular weight of 408.52 g/mol. Its IUPAC name is 6-(methanesulfonamido)-2-[[3-methyl-2-[2-(methylamino)propanoylamino]butanoyl]amino]hexanoic acid.
| Compound Name | 6-(methanesulfonamido)-2-[[3-methyl-2-[2-(methylamino)propanoylamino]butanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 87564470 |
| Molecular Formula | C16H32N4O6S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 6-(methanesulfonamido)-2-[[3-methyl-2-[2-(methylamino)propanoylamino]butanoyl]amino]hexanoic acid |
| SMILES | CNC(C)C(=O)NC(C(=O)NC(CCCCNS(C)(=O)=O)C(=O)O)C(C)C |
| InChI | InChI=1S/C16H32N4O6S/c1-10(2)13(20-14(21)11(3)17-4)15(22)19-12(16(23)24)8-6-7-9-18-27(5,25)26/h10-13,17-18H,6-9H2,1-5H3,(H,19,22)(H,20,21)(H,23,24) |
| InChIKey | GDOLJEHTXANDFX-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 153.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|