C15H31N5O4 — CID 11950296
(2S)-6-amino-2-[[(2S)-2-[[(2S)-2,3-diaminobutanoyl]amino]-3-methylbutanoyl]amino]hexanoic acid (PubChem CID 11950296) has the molecular formula C15H31N5O4 and a molecular weight of 345.44 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[(2S)-2,3-diaminobutanoyl]amino]-3-methylbutanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2,3-diaminobutanoyl]amino]-3-methylbutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 11950296 |
| Molecular Formula | C15H31N5O4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2,3-diaminobutanoyl]amino]-3-methylbutanoyl]amino]hexanoic acid |
| SMILES | CC(N)[C@H](N)C(=O)N[C@H](C(=O)N[C@@H](CCCCN)C(=O)O)C(C)C |
| InChI | InChI=1S/C15H31N5O4/c1-8(2)12(20-13(21)11(18)9(3)17)14(22)19-10(15(23)24)6-4-5-7-16/h8-12H,4-7,16-18H2,1-3H3,(H,19,22)(H,20,21)(H,23,24)/t9?,10-,11-,12-/m0/s1 |
| InChIKey | NZINNFDAEDCBJL-LLTYBXMGSA-N |
| XLogP | -1.50 |
| TPSA | 173.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|