C20H34N4O6 — CID 52943833
methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-6-(3-methylbut-2-enoylamino)hexanoyl]amino]propanoate (PubChem CID 52943833) has the molecular formula C20H34N4O6 and a molecular weight of 426.51 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-6-(3-methylbut-2-enoylamino)hexanoyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-6-(3-methylbut-2-enoylamino)hexanoyl]amino]propanoate |
|---|---|
| PubChem CID | 52943833 |
| Molecular Formula | C20H34N4O6 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-6-(3-methylbut-2-enoylamino)hexanoyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)[C@H](CCCCNC(=O)C=C(C)C)NC(=O)[C@H](C)NC(C)=O |
| InChI | InChI=1S/C20H34N4O6/c1-12(2)11-17(26)21-10-8-7-9-16(19(28)23-14(4)20(29)30-6)24-18(27)13(3)22-15(5)25/h11,13-14,16H,7-10H2,1-6H3,(H,21,26)(H,22,25)(H,23,28)(H,24,27)/t13-,14-,16-/m0/s1 |
| InChIKey | WMJKVGOXCWQOSC-DZKIICNBSA-N |
| XLogP | -0.07 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|