C31H35ClN9OP — CID 155427068
2-[1-[1-[4-[[5-chloro-4-[(5-dimethylphosphorylquinoxalin-6-yl)amino]pyrimidin-2-yl]amino]-2-methylphenyl]piperidin-4-yl]azetidin-3-yl]acetonitrile (PubChem CID 155427068) has the molecular formula C31H35ClN9OP and a molecular weight of 616.11 g/mol. Its IUPAC name is 2-[1-[1-[4-[[5-chloro-4-[(5-dimethylphosphorylquinoxalin-6-yl)amino]pyrimidin-2-yl]amino]-2-methylphenyl]piperidin-4-yl]azetidin-3-yl]acetonitrile.
| Compound Name | 2-[1-[1-[4-[[5-chloro-4-[(5-dimethylphosphorylquinoxalin-6-yl)amino]pyrimidin-2-yl]amino]-2-methylphenyl]piperidin-4-yl]azetidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 155427068 |
| Molecular Formula | C31H35ClN9OP |
| Molecular Weight | 616.11 g/mol |
| Exact Mass | 615.24 |
| IUPAC Name | 2-[1-[1-[4-[[5-chloro-4-[(5-dimethylphosphorylquinoxalin-6-yl)amino]pyrimidin-2-yl]amino]-2-methylphenyl]piperidin-4-yl]azetidin-3-yl]acetonitrile |
| SMILES | Cc1cc(Nc2ncc(Cl)c(Nc3ccc4nccnc4c3P(C)(C)=O)n2)ccc1N1CCC(N2CC(CC#N)C2)CC1 |
| InChI | InChI=1S/C31H35ClN9OP/c1-20-16-22(4-7-27(20)40-14-9-23(10-15-40)41-18-21(19-41)8-11-33)37-31-36-17-24(32)30(39-31)38-26-6-5-25-28(35-13-12-34-25)29(26)43(2,3)42/h4-7,12-13,16-17,21,23H,8-10,14-15,18-19H2,1-3H3,(H2,36,37,38,39) |
| InChIKey | FQTLWYCYUGFLJV-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.11 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|