About (2R)-2-[4-bromo-2-(1,1-difluoroethyl)phenoxy]-3-fluoropropan-1-ol
(2R)-2-[4-bromo-2-(1,1-difluoroethyl)phenoxy]-3-fluoropropan-1-ol (PubChem CID 155428842) has the molecular formula C11H12BrF3O2
and a molecular weight of 313.11 g/mol. Its IUPAC name is (2R)-2-[4-bromo-2-(1,1-difluoroethyl)phenoxy]-3-fluoropropan-1-ol.
Molecular Properties
| Compound Name | (2R)-2-[4-bromo-2-(1,1-difluoroethyl)phenoxy]-3-fluoropropan-1-ol |
| PubChem CID | 155428842 |
| Molecular Formula | C11H12BrF3O2 |
| Molecular Weight | 313.11 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | (2R)-2-[4-bromo-2-(1,1-difluoroethyl)phenoxy]-3-fluoropropan-1-ol |
| SMILES | CC(F)(F)c1cc(Br)ccc1O[C@H](CO)CF |
| InChI | InChI=1S/C11H12BrF3O2/c1-11(14,15)9-4-7(12)2-3-10(9)17-8(5-13)6-16/h2-4,8,16H,5-6H2,1H3/t8-/m0/s1 |
| InChIKey | XBZFKXKFJOOUNX-QMMMGPOBSA-N |
| XLogP | 3.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.11 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-[4-bromo-2-(1,1-difluoroethyl)phenoxy]-3-fluoropropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[4-bromo-2-(1,1-difluoroethyl)phenoxy]-3-fluoropropan-1-ol?
The IUPAC name of (2R)-2-[4-bromo-2-(1,1-difluoroethyl)phenoxy]-3-fluoropropan-1-ol (CID 155428842) is (2R)-2-[4-bromo-2-(1,1-difluoroethyl)phenoxy]-3-fluoropropan-1-ol.
What is the SMILES notation for (2R)-2-[4-bromo-2-(1,1-difluoroethyl)phenoxy]-3-fluoropropan-1-ol?
The canonical SMILES for (2R)-2-[4-bromo-2-(1,1-difluoroethyl)phenoxy]-3-fluoropropan-1-ol is CC(F)(F)c1cc(Br)ccc1O[C@H](CO)CF.
What is the InChIKey of (2R)-2-[4-bromo-2-(1,1-difluoroethyl)phenoxy]-3-fluoropropan-1-ol?
The InChIKey is XBZFKXKFJOOUNX-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H12BrF3O2/c1-11(14,15)9-4-7(12)2-3-10(9)17-8(5-13)6-16/h2-4,8,16H,5-6H2,1H3/t8-/m0/s1.
What are the key properties of (2R)-2-[4-bromo-2-(1,1-difluoroethyl)phenoxy]-3-fluoropropan-1-ol?
(2R)-2-[4-bromo-2-(1,1-difluoroethyl)phenoxy]-3-fluoropropan-1-ol has a molecular weight of 313.11 g/mol, XLogP of 3.27, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[4-bromo-2-(1,1-difluoroethyl)phenoxy]-3-fluoropropan-1-ol is sourced from PubChem (CID 155428842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).