C14H19BrF3NO — CID 150554354
(1S)-1-[4-bromo-2-(trifluoromethyl)phenoxy]-2,4-dimethylpentan-1-amine (PubChem CID 150554354) has the molecular formula C14H19BrF3NO and a molecular weight of 354.21 g/mol. Its IUPAC name is (1S)-1-[4-bromo-2-(trifluoromethyl)phenoxy]-2,4-dimethylpentan-1-amine.
| Compound Name | (1S)-1-[4-bromo-2-(trifluoromethyl)phenoxy]-2,4-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 150554354 |
| Molecular Formula | C14H19BrF3NO |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | (1S)-1-[4-bromo-2-(trifluoromethyl)phenoxy]-2,4-dimethylpentan-1-amine |
| SMILES | CC(C)CC(C)[C@@H](N)Oc1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C14H19BrF3NO/c1-8(2)6-9(3)13(19)20-12-5-4-10(15)7-11(12)14(16,17)18/h4-5,7-9,13H,6,19H2,1-3H3/t9?,13-/m0/s1 |
| InChIKey | IINNRDCVXQBJBL-NCWAPJAISA-N |
| XLogP | 4.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|