C14H17BrF3NO3 — CID 135282250
[4-bromo-2-(trifluoromethyl)phenoxy]-(4-methylpentan-2-yl)carbamic acid (PubChem CID 135282250) has the molecular formula C14H17BrF3NO3 and a molecular weight of 384.19 g/mol. Its IUPAC name is [4-bromo-2-(trifluoromethyl)phenoxy]-(4-methylpentan-2-yl)carbamic acid.
| Compound Name | [4-bromo-2-(trifluoromethyl)phenoxy]-(4-methylpentan-2-yl)carbamic acid |
|---|---|
| PubChem CID | 135282250 |
| Molecular Formula | C14H17BrF3NO3 |
| Molecular Weight | 384.19 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | [4-bromo-2-(trifluoromethyl)phenoxy]-(4-methylpentan-2-yl)carbamic acid |
| SMILES | CC(C)CC(C)N(Oc1ccc(Br)cc1C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C14H17BrF3NO3/c1-8(2)6-9(3)19(13(20)21)22-12-5-4-10(15)7-11(12)14(16,17)18/h4-5,7-9H,6H2,1-3H3,(H,20,21) |
| InChIKey | AZPFYNPHUFAAFW-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.19 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|